C7H13N5S — CID 10559923
3-amino-N-butyl-1,2,4-triazole-1-carbothioamide (PubChem CID 10559923) has the molecular formula C7H13N5S and a molecular weight of 199.28 g/mol. Its IUPAC name is 3-amino-N-butyl-1,2,4-triazole-1-carbothioamide.
| Compound Name | 3-amino-N-butyl-1,2,4-triazole-1-carbothioamide |
|---|---|
| PubChem CID | 10559923 |
| Molecular Formula | C7H13N5S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 3-amino-N-butyl-1,2,4-triazole-1-carbothioamide |
| SMILES | CCCCNC(=S)n1cnc(N)n1 |
| InChI | InChI=1S/C7H13N5S/c1-2-3-4-9-7(13)12-5-10-6(8)11-12/h5H,2-4H2,1H3,(H2,8,11)(H,9,13) |
| InChIKey | TYOFNUWUUWXFMH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|