C9H14N4S — CID 10703674
N-cyclohexyl-1,2,4-triazole-1-carbothioamide (PubChem CID 10703674) has the molecular formula C9H14N4S and a molecular weight of 210.31 g/mol. Its IUPAC name is N-cyclohexyl-1,2,4-triazole-1-carbothioamide.
| Compound Name | N-cyclohexyl-1,2,4-triazole-1-carbothioamide |
|---|---|
| PubChem CID | 10703674 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | N-cyclohexyl-1,2,4-triazole-1-carbothioamide |
| SMILES | S=C(NC1CCCCC1)n1cncn1 |
| InChI | InChI=1S/C9H14N4S/c14-9(13-7-10-6-11-13)12-8-4-2-1-3-5-8/h6-8H,1-5H2,(H,12,14) |
| InChIKey | QLEZOOJSWPRITJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|