C9H15N5S — CID 10609247
5-amino-N-cyclohexyl-1,2,4-triazole-1-carbothioamide (PubChem CID 10609247) has the molecular formula C9H15N5S and a molecular weight of 225.32 g/mol. Its IUPAC name is 5-amino-N-cyclohexyl-1,2,4-triazole-1-carbothioamide.
| Compound Name | 5-amino-N-cyclohexyl-1,2,4-triazole-1-carbothioamide |
|---|---|
| PubChem CID | 10609247 |
| Molecular Formula | C9H15N5S |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 5-amino-N-cyclohexyl-1,2,4-triazole-1-carbothioamide |
| SMILES | Nc1ncnn1C(=S)NC1CCCCC1 |
| InChI | InChI=1S/C9H15N5S/c10-8-11-6-12-14(8)9(15)13-7-4-2-1-3-5-7/h6-7H,1-5H2,(H,13,15)(H2,10,11,12) |
| InChIKey | XTYPOPJXQJCWTF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|