C7H12N4 — CID 103071548
N-methyl-2-(1,2,4-triazol-1-ylmethyl)prop-2-en-1-amine (PubChem CID 103071548) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is N-methyl-2-(1,2,4-triazol-1-ylmethyl)prop-2-en-1-amine.
| Compound Name | N-methyl-2-(1,2,4-triazol-1-ylmethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 103071548 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | N-methyl-2-(1,2,4-triazol-1-ylmethyl)prop-2-en-1-amine |
| SMILES | C=C(CNC)Cn1cncn1 |
| InChI | InChI=1S/C7H12N4/c1-7(3-8-2)4-11-6-9-5-10-11/h5-6,8H,1,3-4H2,2H3 |
| InChIKey | JRVHMXKZSZOPRF-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|