C21H30N2S — CID 8614549
1-[(1R)-1-(1-adamantyl)ethyl]-3-(2,5-dimethylphenyl)thiourea (PubChem CID 8614549) has the molecular formula C21H30N2S and a molecular weight of 342.55 g/mol. Its IUPAC name is 1-[(1R)-1-(1-adamantyl)ethyl]-3-(2,5-dimethylphenyl)thiourea.
| Compound Name | 1-[(1R)-1-(1-adamantyl)ethyl]-3-(2,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 8614549 |
| Molecular Formula | C21H30N2S |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-[(1R)-1-(1-adamantyl)ethyl]-3-(2,5-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)N[C@H](C)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H30N2S/c1-13-4-5-14(2)19(6-13)23-20(24)22-15(3)21-10-16-7-17(11-21)9-18(8-16)12-21/h4-6,15-18H,7-12H2,1-3H3,(H2,22,23,24)/t15-,16?,17?,18?,21?/m1/s1 |
| InChIKey | SMQNYKQYZJOPNE-NEFAXPCMSA-N |
| XLogP | 5.19 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|