C19H25Cl — CID 63430019
1-[chloro-(2,4-dimethylphenyl)methyl]adamantane (PubChem CID 63430019) has the molecular formula C19H25Cl and a molecular weight of 288.86 g/mol. Its IUPAC name is 1-[chloro-(2,4-dimethylphenyl)methyl]adamantane.
| Compound Name | 1-[chloro-(2,4-dimethylphenyl)methyl]adamantane |
|---|---|
| PubChem CID | 63430019 |
| Molecular Formula | C19H25Cl |
| Molecular Weight | 288.86 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-[chloro-(2,4-dimethylphenyl)methyl]adamantane |
| SMILES | Cc1ccc(C(Cl)C23CC4CC(CC(C4)C2)C3)c(C)c1 |
| InChI | InChI=1S/C19H25Cl/c1-12-3-4-17(13(2)5-12)18(20)19-9-14-6-15(10-19)8-16(7-14)11-19/h3-5,14-16,18H,6-11H2,1-2H3 |
| InChIKey | GBMAQAPSUOIYTH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.86 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|