C17H19ClF2 — CID 63434052
1-[chloro-(2,4-difluorophenyl)methyl]adamantane (PubChem CID 63434052) has the molecular formula C17H19ClF2 and a molecular weight of 296.79 g/mol. Its IUPAC name is 1-[chloro-(2,4-difluorophenyl)methyl]adamantane.
| Compound Name | 1-[chloro-(2,4-difluorophenyl)methyl]adamantane |
|---|---|
| PubChem CID | 63434052 |
| Molecular Formula | C17H19ClF2 |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-[chloro-(2,4-difluorophenyl)methyl]adamantane |
| SMILES | Fc1ccc(C(Cl)C23CC4CC(CC(C4)C2)C3)c(F)c1 |
| InChI | InChI=1S/C17H19ClF2/c18-16(14-2-1-13(19)6-15(14)20)17-7-10-3-11(8-17)5-12(4-10)9-17/h1-2,6,10-12,16H,3-5,7-9H2 |
| InChIKey | BINLRVPHQVSRAO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|