C18H21BrF2 — CID 79987420
1-[2-bromo-2-(2,5-difluorophenyl)ethyl]adamantane (PubChem CID 79987420) has the molecular formula C18H21BrF2 and a molecular weight of 355.27 g/mol. Its IUPAC name is 1-[2-bromo-2-(2,5-difluorophenyl)ethyl]adamantane.
| Compound Name | 1-[2-bromo-2-(2,5-difluorophenyl)ethyl]adamantane |
|---|---|
| PubChem CID | 79987420 |
| Molecular Formula | C18H21BrF2 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 1-[2-bromo-2-(2,5-difluorophenyl)ethyl]adamantane |
| SMILES | Fc1ccc(F)c(C(Br)CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C18H21BrF2/c19-16(15-6-14(20)1-2-17(15)21)10-18-7-11-3-12(8-18)5-13(4-11)9-18/h1-2,6,11-13,16H,3-5,7-10H2 |
| InChIKey | KOKJEYIIFAEKDX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|