C13H15BrF2O — CID 65158065
2-[3-bromo-3-(2,5-difluorophenyl)propyl]oxolane (PubChem CID 65158065) has the molecular formula C13H15BrF2O and a molecular weight of 305.16 g/mol. Its IUPAC name is 2-[3-bromo-3-(2,5-difluorophenyl)propyl]oxolane.
| Compound Name | 2-[3-bromo-3-(2,5-difluorophenyl)propyl]oxolane |
|---|---|
| PubChem CID | 65158065 |
| Molecular Formula | C13H15BrF2O |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-[3-bromo-3-(2,5-difluorophenyl)propyl]oxolane |
| SMILES | Fc1ccc(F)c(C(Br)CCC2CCCO2)c1 |
| InChI | InChI=1S/C13H15BrF2O/c14-12(5-4-10-2-1-7-17-10)11-8-9(15)3-6-13(11)16/h3,6,8,10,12H,1-2,4-5,7H2 |
| InChIKey | VSTFPXLMPDVJAB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|