C14H16BrF3O — CID 103304271
2-[3-bromo-3-(2,4,5-trifluorophenyl)propyl]oxane (PubChem CID 103304271) has the molecular formula C14H16BrF3O and a molecular weight of 337.18 g/mol. Its IUPAC name is 2-[3-bromo-3-(2,4,5-trifluorophenyl)propyl]oxane.
| Compound Name | 2-[3-bromo-3-(2,4,5-trifluorophenyl)propyl]oxane |
|---|---|
| PubChem CID | 103304271 |
| Molecular Formula | C14H16BrF3O |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 2-[3-bromo-3-(2,4,5-trifluorophenyl)propyl]oxane |
| SMILES | Fc1cc(F)c(C(Br)CCC2CCCCO2)cc1F |
| InChI | InChI=1S/C14H16BrF3O/c15-11(5-4-9-3-1-2-6-19-9)10-7-13(17)14(18)8-12(10)16/h7-9,11H,1-6H2 |
| InChIKey | QUVLCXFHHJGZGO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|