C12H12BrF3O — CID 103304168
2-[bromo-(2,4,5-trifluorophenyl)methyl]oxane (PubChem CID 103304168) has the molecular formula C12H12BrF3O and a molecular weight of 309.12 g/mol. Its IUPAC name is 2-[bromo-(2,4,5-trifluorophenyl)methyl]oxane.
| Compound Name | 2-[bromo-(2,4,5-trifluorophenyl)methyl]oxane |
|---|---|
| PubChem CID | 103304168 |
| Molecular Formula | C12H12BrF3O |
| Molecular Weight | 309.12 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 2-[bromo-(2,4,5-trifluorophenyl)methyl]oxane |
| SMILES | Fc1cc(F)c(C(Br)C2CCCCO2)cc1F |
| InChI | InChI=1S/C12H12BrF3O/c13-12(11-3-1-2-4-17-11)7-5-9(15)10(16)6-8(7)14/h5-6,11-12H,1-4H2 |
| InChIKey | BQOGLILFBGLQAI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.12 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|