C13H17BrO — CID 61097286
2-[bromo-(2,4-dimethylphenyl)methyl]oxolane (PubChem CID 61097286) has the molecular formula C13H17BrO and a molecular weight of 269.18 g/mol. Its IUPAC name is 2-[bromo-(2,4-dimethylphenyl)methyl]oxolane.
| Compound Name | 2-[bromo-(2,4-dimethylphenyl)methyl]oxolane |
|---|---|
| PubChem CID | 61097286 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-[bromo-(2,4-dimethylphenyl)methyl]oxolane |
| SMILES | Cc1ccc(C(Br)C2CCCO2)c(C)c1 |
| InChI | InChI=1S/C13H17BrO/c1-9-5-6-11(10(2)8-9)13(14)12-4-3-7-15-12/h5-6,8,12-13H,3-4,7H2,1-2H3 |
| InChIKey | GRLVEOMLDQIIRE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|