C15H21Br — CID 107182184
1-[bromo-(2-methylcyclopentyl)methyl]-2,4-dimethylbenzene (PubChem CID 107182184) has the molecular formula C15H21Br and a molecular weight of 281.24 g/mol. Its IUPAC name is 1-[bromo-(2-methylcyclopentyl)methyl]-2,4-dimethylbenzene.
| Compound Name | 1-[bromo-(2-methylcyclopentyl)methyl]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 107182184 |
| Molecular Formula | C15H21Br |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-[bromo-(2-methylcyclopentyl)methyl]-2,4-dimethylbenzene |
| SMILES | Cc1ccc(C(Br)C2CCCC2C)c(C)c1 |
| InChI | InChI=1S/C15H21Br/c1-10-7-8-14(12(3)9-10)15(16)13-6-4-5-11(13)2/h7-9,11,13,15H,4-6H2,1-3H3 |
| InChIKey | ZFBRCOBBSZZPQL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|