C10H14BrN — CID 116961880
1-bromo-1-(2,4-dimethylphenyl)-N-methylmethanamine (PubChem CID 116961880) has the molecular formula C10H14BrN and a molecular weight of 228.13 g/mol. Its IUPAC name is 1-bromo-1-(2,4-dimethylphenyl)-N-methylmethanamine.
| Compound Name | 1-bromo-1-(2,4-dimethylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 116961880 |
| Molecular Formula | C10H14BrN |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 1-bromo-1-(2,4-dimethylphenyl)-N-methylmethanamine |
| SMILES | CNC(Br)c1ccc(C)cc1C |
| InChI | InChI=1S/C10H14BrN/c1-7-4-5-9(8(2)6-7)10(11)12-3/h4-6,10,12H,1-3H3 |
| InChIKey | NKRSNUSNGJAEOM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|