C11H15NO — CID 116954143
2-(2,4-dimethylphenyl)-2-(methylamino)acetaldehyde (PubChem CID 116954143) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-2-(methylamino)acetaldehyde.
| Compound Name | 2-(2,4-dimethylphenyl)-2-(methylamino)acetaldehyde |
|---|---|
| PubChem CID | 116954143 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-2-(methylamino)acetaldehyde |
| SMILES | CNC(C=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C11H15NO/c1-8-4-5-10(9(2)6-8)11(7-13)12-3/h4-7,11-12H,1-3H3 |
| InChIKey | ZKHKSUZECUXBEN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|