C17H20F2O — CID 63410694
1-adamantyl-(2,5-difluorophenyl)methanol (PubChem CID 63410694) has the molecular formula C17H20F2O and a molecular weight of 278.34 g/mol. Its IUPAC name is 1-adamantyl-(2,5-difluorophenyl)methanol.
| Compound Name | 1-adamantyl-(2,5-difluorophenyl)methanol |
|---|---|
| PubChem CID | 63410694 |
| Molecular Formula | C17H20F2O |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-adamantyl-(2,5-difluorophenyl)methanol |
| SMILES | OC(c1cc(F)ccc1F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H20F2O/c18-13-1-2-15(19)14(6-13)16(20)17-7-10-3-11(8-17)5-12(4-10)9-17/h1-2,6,10-12,16,20H,3-5,7-9H2 |
| InChIKey | GHXPOLFRLMPCHP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |