C10H11F2NO — CID 130510268
azetidin-3-yl-(2,5-difluorophenyl)methanol (PubChem CID 130510268) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is azetidin-3-yl-(2,5-difluorophenyl)methanol.
| Compound Name | azetidin-3-yl-(2,5-difluorophenyl)methanol |
|---|---|
| PubChem CID | 130510268 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | azetidin-3-yl-(2,5-difluorophenyl)methanol |
| SMILES | OC(c1cc(F)ccc1F)C1CNC1 |
| InChI | InChI=1S/C10H11F2NO/c11-7-1-2-9(12)8(3-7)10(14)6-4-13-5-6/h1-3,6,10,13-14H,4-5H2 |
| InChIKey | BUWXICWVCNMSSG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |