C12H14F2OS — CID 105094902
(2,5-difluorophenyl)-(2-methylthiolan-2-yl)methanol (PubChem CID 105094902) has the molecular formula C12H14F2OS and a molecular weight of 244.31 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(2-methylthiolan-2-yl)methanol.
| Compound Name | (2,5-difluorophenyl)-(2-methylthiolan-2-yl)methanol |
|---|---|
| PubChem CID | 105094902 |
| Molecular Formula | C12H14F2OS |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (2,5-difluorophenyl)-(2-methylthiolan-2-yl)methanol |
| SMILES | CC1(C(O)c2cc(F)ccc2F)CCCS1 |
| InChI | InChI=1S/C12H14F2OS/c1-12(5-2-6-16-12)11(15)9-7-8(13)3-4-10(9)14/h3-4,7,11,15H,2,5-6H2,1H3 |
| InChIKey | VIGJMZQNOHWJMT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |