C14H20OS — CID 105091741
(3,4-dimethylphenyl)-(2-methylthiolan-2-yl)methanol (PubChem CID 105091741) has the molecular formula C14H20OS and a molecular weight of 236.38 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-(2-methylthiolan-2-yl)methanol.
| Compound Name | (3,4-dimethylphenyl)-(2-methylthiolan-2-yl)methanol |
|---|---|
| PubChem CID | 105091741 |
| Molecular Formula | C14H20OS |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (3,4-dimethylphenyl)-(2-methylthiolan-2-yl)methanol |
| SMILES | Cc1ccc(C(O)C2(C)CCCS2)cc1C |
| InChI | InChI=1S/C14H20OS/c1-10-5-6-12(9-11(10)2)13(15)14(3)7-4-8-16-14/h5-6,9,13,15H,4,7-8H2,1-3H3 |
| InChIKey | WWELANUBWVRLOR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |