C13H16BrFOS — CID 105088454
2-(2-bromo-5-fluorophenyl)-1-(2-methylthiolan-2-yl)ethanol (PubChem CID 105088454) has the molecular formula C13H16BrFOS and a molecular weight of 319.24 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-1-(2-methylthiolan-2-yl)ethanol.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-1-(2-methylthiolan-2-yl)ethanol |
|---|---|
| PubChem CID | 105088454 |
| Molecular Formula | C13H16BrFOS |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-1-(2-methylthiolan-2-yl)ethanol |
| SMILES | CC1(C(O)Cc2cc(F)ccc2Br)CCCS1 |
| InChI | InChI=1S/C13H16BrFOS/c1-13(5-2-6-17-13)12(16)8-9-7-10(15)3-4-11(9)14/h3-4,7,12,16H,2,5-6,8H2,1H3 |
| InChIKey | BMGGRCAGDVCMTH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |