C15H21BrFN — CID 115843879
2-(2-bromo-5-fluorophenyl)-N-methyl-1-(1-methylcyclopentyl)ethanamine (PubChem CID 115843879) has the molecular formula C15H21BrFN and a molecular weight of 314.24 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-N-methyl-1-(1-methylcyclopentyl)ethanamine.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-N-methyl-1-(1-methylcyclopentyl)ethanamine |
|---|---|
| PubChem CID | 115843879 |
| Molecular Formula | C15H21BrFN |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-N-methyl-1-(1-methylcyclopentyl)ethanamine |
| SMILES | CNC(Cc1cc(F)ccc1Br)C1(C)CCCC1 |
| InChI | InChI=1S/C15H21BrFN/c1-15(7-3-4-8-15)14(18-2)10-11-9-12(17)5-6-13(11)16/h5-6,9,14,18H,3-4,7-8,10H2,1-2H3 |
| InChIKey | GGHIQISFXYIICJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |