C14H19BrFN — CID 115843507
2-(2-bromo-5-fluorophenyl)-1-(1-methylcyclopentyl)ethanamine (PubChem CID 115843507) has the molecular formula C14H19BrFN and a molecular weight of 300.21 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-1-(1-methylcyclopentyl)ethanamine.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-1-(1-methylcyclopentyl)ethanamine |
|---|---|
| PubChem CID | 115843507 |
| Molecular Formula | C14H19BrFN |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-1-(1-methylcyclopentyl)ethanamine |
| SMILES | CC1(C(N)Cc2cc(F)ccc2Br)CCCC1 |
| InChI | InChI=1S/C14H19BrFN/c1-14(6-2-3-7-14)13(17)9-10-8-11(16)4-5-12(10)15/h4-5,8,13H,2-3,6-7,9,17H2,1H3 |
| InChIKey | DDFDHRSYERCSIF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |