C13H19BrFN — CID 62599843
1-(2-bromo-5-fluorophenyl)-N,3,3-trimethylbutan-2-amine (PubChem CID 62599843) has the molecular formula C13H19BrFN and a molecular weight of 288.20 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-N,3,3-trimethylbutan-2-amine.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-N,3,3-trimethylbutan-2-amine |
|---|---|
| PubChem CID | 62599843 |
| Molecular Formula | C13H19BrFN |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-N,3,3-trimethylbutan-2-amine |
| SMILES | CNC(Cc1cc(F)ccc1Br)C(C)(C)C |
| InChI | InChI=1S/C13H19BrFN/c1-13(2,3)12(16-4)8-9-7-10(15)5-6-11(9)14/h5-7,12,16H,8H2,1-4H3 |
| InChIKey | LEGUHGCWGXLUMK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |