About 1-[chloro-(2-chloro-4,5-difluorophenyl)methyl]adamantane
1-[chloro-(2-chloro-4,5-difluorophenyl)methyl]adamantane (PubChem CID 107477280) has the molecular formula C17H18Cl2F2
and a molecular weight of 331.23 g/mol. Its IUPAC name is 1-[chloro-(2-chloro-4,5-difluorophenyl)methyl]adamantane.
Molecular Properties
| Compound Name | 1-[chloro-(2-chloro-4,5-difluorophenyl)methyl]adamantane |
| PubChem CID | 107477280 |
| Molecular Formula | C17H18Cl2F2 |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-[chloro-(2-chloro-4,5-difluorophenyl)methyl]adamantane |
| SMILES | Fc1cc(Cl)c(C(Cl)C23CC4CC(CC(C4)C2)C3)cc1F |
| InChI | InChI=1S/C17H18Cl2F2/c18-13-5-15(21)14(20)4-12(13)16(19)17-6-9-1-10(7-17)3-11(2-9)8-17/h4-5,9-11,16H,1-3,6-8H2 |
| InChIKey | XSPRIRBNZYLNHP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[chloro-(2-chloro-4,5-difluorophenyl)methyl]adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[chloro-(2-chloro-4,5-difluorophenyl)methyl]adamantane?
The IUPAC name of 1-[chloro-(2-chloro-4,5-difluorophenyl)methyl]adamantane (CID 107477280) is 1-[chloro-(2-chloro-4,5-difluorophenyl)methyl]adamantane.
What is the SMILES notation for 1-[chloro-(2-chloro-4,5-difluorophenyl)methyl]adamantane?
The canonical SMILES for 1-[chloro-(2-chloro-4,5-difluorophenyl)methyl]adamantane is Fc1cc(Cl)c(C(Cl)C23CC4CC(CC(C4)C2)C3)cc1F.
What is the InChIKey of 1-[chloro-(2-chloro-4,5-difluorophenyl)methyl]adamantane?
The InChIKey is XSPRIRBNZYLNHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2F2/c18-13-5-15(21)14(20)4-12(13)16(19)17-6-9-1-10(7-17)3-11(2-9)8-17/h4-5,9-11,16H,1-3,6-8H2.
What are the key properties of 1-[chloro-(2-chloro-4,5-difluorophenyl)methyl]adamantane?
1-[chloro-(2-chloro-4,5-difluorophenyl)methyl]adamantane has a molecular weight of 331.23 g/mol, XLogP of 6.11, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[chloro-(2-chloro-4,5-difluorophenyl)methyl]adamantane is sourced from PubChem (CID 107477280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).