C13H14Cl2F2 — CID 107477309
1-chloro-2-(1-chloro-2-cyclopentylethyl)-4,5-difluorobenzene (PubChem CID 107477309) has the molecular formula C13H14Cl2F2 and a molecular weight of 279.16 g/mol. Its IUPAC name is 1-chloro-2-(1-chloro-2-cyclopentylethyl)-4,5-difluorobenzene.
| Compound Name | 1-chloro-2-(1-chloro-2-cyclopentylethyl)-4,5-difluorobenzene |
|---|---|
| PubChem CID | 107477309 |
| Molecular Formula | C13H14Cl2F2 |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 1-chloro-2-(1-chloro-2-cyclopentylethyl)-4,5-difluorobenzene |
| SMILES | Fc1cc(Cl)c(C(Cl)CC2CCCC2)cc1F |
| InChI | InChI=1S/C13H14Cl2F2/c14-10(5-8-3-1-2-4-8)9-6-12(16)13(17)7-11(9)15/h6-8,10H,1-5H2 |
| InChIKey | UOTZDPRYLSXAIK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|