C14H16Cl2F2 — CID 107477301
1-chloro-2-(1-chloro-3-cyclopentylpropyl)-4,5-difluorobenzene (PubChem CID 107477301) has the molecular formula C14H16Cl2F2 and a molecular weight of 293.18 g/mol. Its IUPAC name is 1-chloro-2-(1-chloro-3-cyclopentylpropyl)-4,5-difluorobenzene.
| Compound Name | 1-chloro-2-(1-chloro-3-cyclopentylpropyl)-4,5-difluorobenzene |
|---|---|
| PubChem CID | 107477301 |
| Molecular Formula | C14H16Cl2F2 |
| Molecular Weight | 293.18 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1-chloro-2-(1-chloro-3-cyclopentylpropyl)-4,5-difluorobenzene |
| SMILES | Fc1cc(Cl)c(C(Cl)CCC2CCCC2)cc1F |
| InChI | InChI=1S/C14H16Cl2F2/c15-11(6-5-9-3-1-2-4-9)10-7-13(17)14(18)8-12(10)16/h7-9,11H,1-6H2 |
| InChIKey | HAGUVUDBMXWXJS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.18 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|