C14H21ClS — CID 63432096
3-(1-chloro-3-cyclopentylpropyl)-2,5-dimethylthiophene (PubChem CID 63432096) has the molecular formula C14H21ClS and a molecular weight of 256.84 g/mol. Its IUPAC name is 3-(1-chloro-3-cyclopentylpropyl)-2,5-dimethylthiophene.
| Compound Name | 3-(1-chloro-3-cyclopentylpropyl)-2,5-dimethylthiophene |
|---|---|
| PubChem CID | 63432096 |
| Molecular Formula | C14H21ClS |
| Molecular Weight | 256.84 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-(1-chloro-3-cyclopentylpropyl)-2,5-dimethylthiophene |
| SMILES | Cc1cc(C(Cl)CCC2CCCC2)c(C)s1 |
| InChI | InChI=1S/C14H21ClS/c1-10-9-13(11(2)16-10)14(15)8-7-12-5-3-4-6-12/h9,12,14H,3-8H2,1-2H3 |
| InChIKey | DZYVESFKXMOCJL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.84 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|