C10H10Cl2F2 — CID 107477429
1-chloro-2-(1-chloro-2-methylpropyl)-4,5-difluorobenzene (PubChem CID 107477429) has the molecular formula C10H10Cl2F2 and a molecular weight of 239.09 g/mol. Its IUPAC name is 1-chloro-2-(1-chloro-2-methylpropyl)-4,5-difluorobenzene.
| Compound Name | 1-chloro-2-(1-chloro-2-methylpropyl)-4,5-difluorobenzene |
|---|---|
| PubChem CID | 107477429 |
| Molecular Formula | C10H10Cl2F2 |
| Molecular Weight | 239.09 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 1-chloro-2-(1-chloro-2-methylpropyl)-4,5-difluorobenzene |
| SMILES | CC(C)C(Cl)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C10H10Cl2F2/c1-5(2)10(12)6-3-8(13)9(14)4-7(6)11/h3-5,10H,1-2H3 |
| InChIKey | OJLMQSAPQRJVGZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.09 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|