C12H16ClF2N — CID 103852510
1-(2-chloro-4,5-difluorophenyl)-3,3-dimethylbutan-1-amine (PubChem CID 103852510) has the molecular formula C12H16ClF2N and a molecular weight of 247.72 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-3,3-dimethylbutan-1-amine.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 103852510 |
| Molecular Formula | C12H16ClF2N |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-3,3-dimethylbutan-1-amine |
| SMILES | CC(C)(C)CC(N)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C12H16ClF2N/c1-12(2,3)6-11(16)7-4-9(14)10(15)5-8(7)13/h4-5,11H,6,16H2,1-3H3 |
| InChIKey | PQOCHCXUDDJJHX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|