C9H10ClF2N — CID 112693699
1-(4-chloro-2,5-difluorophenyl)propan-1-amine (PubChem CID 112693699) has the molecular formula C9H10ClF2N and a molecular weight of 205.64 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)propan-1-amine.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 112693699 |
| Molecular Formula | C9H10ClF2N |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)propan-1-amine |
| SMILES | CCC(N)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C9H10ClF2N/c1-2-9(13)5-3-8(12)6(10)4-7(5)11/h3-4,9H,2,13H2,1H3 |
| InChIKey | QIGQKENKUDEVAP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|