C10H10ClF2N — CID 130691292
(1R)-1-(4-chloro-2,5-difluorophenyl)but-3-en-1-amine (PubChem CID 130691292) has the molecular formula C10H10ClF2N and a molecular weight of 217.65 g/mol. Its IUPAC name is (1R)-1-(4-chloro-2,5-difluorophenyl)but-3-en-1-amine.
| Compound Name | (1R)-1-(4-chloro-2,5-difluorophenyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 130691292 |
| Molecular Formula | C10H10ClF2N |
| Molecular Weight | 217.65 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | (1R)-1-(4-chloro-2,5-difluorophenyl)but-3-en-1-amine |
| SMILES | C=CC[C@@H](N)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C10H10ClF2N/c1-2-3-10(14)6-4-9(13)7(11)5-8(6)12/h2,4-5,10H,1,3,14H2/t10-/m1/s1 |
| InChIKey | ILQFCVBHEDMFFB-SNVBAGLBSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.65 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|