C10H11ClFNO — CID 131143638
2-[(1R)-1-aminobut-3-enyl]-4-chloro-6-fluorophenol (PubChem CID 131143638) has the molecular formula C10H11ClFNO and a molecular weight of 215.66 g/mol. Its IUPAC name is 2-[(1R)-1-aminobut-3-enyl]-4-chloro-6-fluorophenol.
| Compound Name | 2-[(1R)-1-aminobut-3-enyl]-4-chloro-6-fluorophenol |
|---|---|
| PubChem CID | 131143638 |
| Molecular Formula | C10H11ClFNO |
| Molecular Weight | 215.66 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 2-[(1R)-1-aminobut-3-enyl]-4-chloro-6-fluorophenol |
| SMILES | C=CC[C@@H](N)c1cc(Cl)cc(F)c1O |
| InChI | InChI=1S/C10H11ClFNO/c1-2-3-9(13)7-4-6(11)5-8(12)10(7)14/h2,4-5,9,14H,1,3,13H2/t9-/m1/s1 |
| InChIKey | KMRJGLAICAWOTD-SECBINFHSA-N |
| XLogP | 2.76 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.66 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|