C17H26ClF2N — CID 107476446
1-(2-chloro-4,5-difluorophenyl)-N-ethyl-3,5,5-trimethylhexan-1-amine (PubChem CID 107476446) has the molecular formula C17H26ClF2N and a molecular weight of 317.85 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-N-ethyl-3,5,5-trimethylhexan-1-amine.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-N-ethyl-3,5,5-trimethylhexan-1-amine |
|---|---|
| PubChem CID | 107476446 |
| Molecular Formula | C17H26ClF2N |
| Molecular Weight | 317.85 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-N-ethyl-3,5,5-trimethylhexan-1-amine |
| SMILES | CCNC(CC(C)CC(C)(C)C)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C17H26ClF2N/c1-6-21-16(7-11(2)10-17(3,4)5)12-8-14(19)15(20)9-13(12)18/h8-9,11,16,21H,6-7,10H2,1-5H3 |
| InChIKey | DGQKAAWLLZCPDP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.85 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|