C18H29Cl2N — CID 63501748
1-(2,4-dichlorophenyl)-3,5,5-trimethyl-N-propylhexan-1-amine (PubChem CID 63501748) has the molecular formula C18H29Cl2N and a molecular weight of 330.34 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3,5,5-trimethyl-N-propylhexan-1-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-3,5,5-trimethyl-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 63501748 |
| Molecular Formula | C18H29Cl2N |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3,5,5-trimethyl-N-propylhexan-1-amine |
| SMILES | CCCNC(CC(C)CC(C)(C)C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H29Cl2N/c1-6-9-21-17(10-13(2)12-18(3,4)5)15-8-7-14(19)11-16(15)20/h7-8,11,13,17,21H,6,9-10,12H2,1-5H3 |
| InChIKey | PCCGZCVHTXDAQT-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |