C16H25Cl2NO — CID 107151471
1-[1-(2,4-dichlorophenyl)propylamino]-4,4-dimethylpentan-2-ol (PubChem CID 107151471) has the molecular formula C16H25Cl2NO and a molecular weight of 318.29 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)propylamino]-4,4-dimethylpentan-2-ol.
| Compound Name | 1-[1-(2,4-dichlorophenyl)propylamino]-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 107151471 |
| Molecular Formula | C16H25Cl2NO |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)propylamino]-4,4-dimethylpentan-2-ol |
| SMILES | CCC(NCC(O)CC(C)(C)C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H25Cl2NO/c1-5-15(13-7-6-11(17)8-14(13)18)19-10-12(20)9-16(2,3)4/h6-8,12,15,19-20H,5,9-10H2,1-4H3 |
| InChIKey | KXJJYKKKKCPHEI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |