C13H16ClF2NO2 — CID 107476711
5-amino-5-(2-chloro-4,5-difluorophenyl)-3,3-dimethylpentanoic acid (PubChem CID 107476711) has the molecular formula C13H16ClF2NO2 and a molecular weight of 291.73 g/mol. Its IUPAC name is 5-amino-5-(2-chloro-4,5-difluorophenyl)-3,3-dimethylpentanoic acid.
| Compound Name | 5-amino-5-(2-chloro-4,5-difluorophenyl)-3,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 107476711 |
| Molecular Formula | C13H16ClF2NO2 |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 5-amino-5-(2-chloro-4,5-difluorophenyl)-3,3-dimethylpentanoic acid |
| SMILES | CC(C)(CC(=O)O)CC(N)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C13H16ClF2NO2/c1-13(2,6-12(18)19)5-11(17)7-3-9(15)10(16)4-8(7)14/h3-4,11H,5-6,17H2,1-2H3,(H,18,19) |
| InChIKey | UMQZRRRPYXVIJF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|