C14H19Br2NO2 — CID 81473050
5-amino-5-(2,5-dibromo-4-methylphenyl)-3,3-dimethylpentanoic acid (PubChem CID 81473050) has the molecular formula C14H19Br2NO2 and a molecular weight of 393.12 g/mol. Its IUPAC name is 5-amino-5-(2,5-dibromo-4-methylphenyl)-3,3-dimethylpentanoic acid.
| Compound Name | 5-amino-5-(2,5-dibromo-4-methylphenyl)-3,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 81473050 |
| Molecular Formula | C14H19Br2NO2 |
| Molecular Weight | 393.12 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 5-amino-5-(2,5-dibromo-4-methylphenyl)-3,3-dimethylpentanoic acid |
| SMILES | Cc1cc(Br)c(C(N)CC(C)(C)CC(=O)O)cc1Br |
| InChI | InChI=1S/C14H19Br2NO2/c1-8-4-11(16)9(5-10(8)15)12(17)6-14(2,3)7-13(18)19/h4-5,12H,6-7,17H2,1-3H3,(H,18,19) |
| InChIKey | BIOYMBSHBMGLNR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.12 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |