C13H18BrNO2 — CID 116938329
4-amino-4-(5-bromo-2-methylphenyl)-3,3-dimethylbutanoic acid (PubChem CID 116938329) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is 4-amino-4-(5-bromo-2-methylphenyl)-3,3-dimethylbutanoic acid.
| Compound Name | 4-amino-4-(5-bromo-2-methylphenyl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 116938329 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4-amino-4-(5-bromo-2-methylphenyl)-3,3-dimethylbutanoic acid |
| SMILES | Cc1ccc(Br)cc1C(N)C(C)(C)CC(=O)O |
| InChI | InChI=1S/C13H18BrNO2/c1-8-4-5-9(14)6-10(8)12(15)13(2,3)7-11(16)17/h4-6,12H,7,15H2,1-3H3,(H,16,17) |
| InChIKey | LEWNQSXHXTWNBH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |