C13H18BrNO2 — CID 68628751
[1-(5-bromo-2-methylphenyl)-2,2-dimethylpropyl]carbamic acid (PubChem CID 68628751) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is [1-(5-bromo-2-methylphenyl)-2,2-dimethylpropyl]carbamic acid.
| Compound Name | [1-(5-bromo-2-methylphenyl)-2,2-dimethylpropyl]carbamic acid |
|---|---|
| PubChem CID | 68628751 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | [1-(5-bromo-2-methylphenyl)-2,2-dimethylpropyl]carbamic acid |
| SMILES | Cc1ccc(Br)cc1C(NC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H18BrNO2/c1-8-5-6-9(14)7-10(8)11(13(2,3)4)15-12(16)17/h5-7,11,15H,1-4H3,(H,16,17) |
| InChIKey | WNRATQJMTWRZSA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |