C10H11BrO4 — CID 170825023
3-(5-bromo-2-methylphenyl)-2,3-dihydroxypropanoic acid (PubChem CID 170825023) has the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. Its IUPAC name is 3-(5-bromo-2-methylphenyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(5-bromo-2-methylphenyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170825023 |
| Molecular Formula | C10H11BrO4 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 3-(5-bromo-2-methylphenyl)-2,3-dihydroxypropanoic acid |
| SMILES | Cc1ccc(Br)cc1C(O)C(O)C(=O)O |
| InChI | InChI=1S/C10H11BrO4/c1-5-2-3-6(11)4-7(5)8(12)9(13)10(14)15/h2-4,8-9,12-13H,1H3,(H,14,15) |
| InChIKey | BAGNZCVWRICWQG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |