C11H13BrO4 — CID 170825075
3-(4-bromo-2,6-dimethylphenyl)-2,3-dihydroxypropanoic acid (PubChem CID 170825075) has the molecular formula C11H13BrO4 and a molecular weight of 289.13 g/mol. Its IUPAC name is 3-(4-bromo-2,6-dimethylphenyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(4-bromo-2,6-dimethylphenyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170825075 |
| Molecular Formula | C11H13BrO4 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 3-(4-bromo-2,6-dimethylphenyl)-2,3-dihydroxypropanoic acid |
| SMILES | Cc1cc(Br)cc(C)c1C(O)C(O)C(=O)O |
| InChI | InChI=1S/C11H13BrO4/c1-5-3-7(12)4-6(2)8(5)9(13)10(14)11(15)16/h3-4,9-10,13-14H,1-2H3,(H,15,16) |
| InChIKey | ZWFOJCPOZLXWJF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |