C9H11BrO2 — CID 21336315
(4-bromo-2,6-dimethylphenyl)methanediol (PubChem CID 21336315) has the molecular formula C9H11BrO2 and a molecular weight of 231.09 g/mol. Its IUPAC name is (4-bromo-2,6-dimethylphenyl)methanediol.
| Compound Name | (4-bromo-2,6-dimethylphenyl)methanediol |
|---|---|
| PubChem CID | 21336315 |
| Molecular Formula | C9H11BrO2 |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | (4-bromo-2,6-dimethylphenyl)methanediol |
| SMILES | Cc1cc(Br)cc(C)c1C(O)O |
| InChI | InChI=1S/C9H11BrO2/c1-5-3-7(10)4-6(2)8(5)9(11)12/h3-4,9,11-12H,1-2H3 |
| InChIKey | UBRJIXNXWOKROI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|