C14H19Cl2NO2 — CID 62933676
methyl 5-amino-5-(2,4-dichlorophenyl)-3,3-dimethylpentanoate (PubChem CID 62933676) has the molecular formula C14H19Cl2NO2 and a molecular weight of 304.22 g/mol. Its IUPAC name is methyl 5-amino-5-(2,4-dichlorophenyl)-3,3-dimethylpentanoate.
| Compound Name | methyl 5-amino-5-(2,4-dichlorophenyl)-3,3-dimethylpentanoate |
|---|---|
| PubChem CID | 62933676 |
| Molecular Formula | C14H19Cl2NO2 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | methyl 5-amino-5-(2,4-dichlorophenyl)-3,3-dimethylpentanoate |
| SMILES | COC(=O)CC(C)(C)CC(N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2NO2/c1-14(2,8-13(18)19-3)7-12(17)10-5-4-9(15)6-11(10)16/h4-6,12H,7-8,17H2,1-3H3 |
| InChIKey | ULYBPBGOPCOZDC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |