C13H17Cl2NO2 — CID 65297367
methyl 4-amino-4-(2,5-dichlorophenyl)-2,2-dimethylbutanoate (PubChem CID 65297367) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is methyl 4-amino-4-(2,5-dichlorophenyl)-2,2-dimethylbutanoate.
| Compound Name | methyl 4-amino-4-(2,5-dichlorophenyl)-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 65297367 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | methyl 4-amino-4-(2,5-dichlorophenyl)-2,2-dimethylbutanoate |
| SMILES | COC(=O)C(C)(C)CC(N)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H17Cl2NO2/c1-13(2,12(17)18-3)7-11(16)9-6-8(14)4-5-10(9)15/h4-6,11H,7,16H2,1-3H3 |
| InChIKey | UWXGCVAMCGEPGB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |