About methyl 4-amino-4-(2,5-dimethylphenyl)-2,2-dimethylbutanoate
methyl 4-amino-4-(2,5-dimethylphenyl)-2,2-dimethylbutanoate (PubChem CID 65298096) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is methyl 4-amino-4-(2,5-dimethylphenyl)-2,2-dimethylbutanoate.
Analyze methyl 4-amino-4-(2,5-dimethylphenyl)-2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-4-(2,5-dimethylphenyl)-2,2-dimethylbutanoate?
The IUPAC name of methyl 4-amino-4-(2,5-dimethylphenyl)-2,2-dimethylbutanoate (CID 65298096) is methyl 4-amino-4-(2,5-dimethylphenyl)-2,2-dimethylbutanoate.
What is the SMILES notation for methyl 4-amino-4-(2,5-dimethylphenyl)-2,2-dimethylbutanoate?
The canonical SMILES for methyl 4-amino-4-(2,5-dimethylphenyl)-2,2-dimethylbutanoate is COC(=O)C(C)(C)CC(N)c1cc(C)ccc1C.
What is the InChIKey of methyl 4-amino-4-(2,5-dimethylphenyl)-2,2-dimethylbutanoate?
The InChIKey is XTKBOJYWEZJAFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2/c1-10-6-7-11(2)12(8-10)13(16)9-15(3,4)14(17)18-5/h6-8,13H,9,16H2,1-5H3.
What are the key properties of methyl 4-amino-4-(2,5-dimethylphenyl)-2,2-dimethylbutanoate?
methyl 4-amino-4-(2,5-dimethylphenyl)-2,2-dimethylbutanoate has a molecular weight of 249.35 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-4-(2,5-dimethylphenyl)-2,2-dimethylbutanoate is sourced from PubChem (CID 65298096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).