C15H22O3 — CID 146594255
ethyl 3-(2,5-dimethylphenoxy)-2,2-dimethylpropanoate (PubChem CID 146594255) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is ethyl 3-(2,5-dimethylphenoxy)-2,2-dimethylpropanoate.
| Compound Name | ethyl 3-(2,5-dimethylphenoxy)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146594255 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | ethyl 3-(2,5-dimethylphenoxy)-2,2-dimethylpropanoate |
| SMILES | CCOC(=O)C(C)(C)COc1cc(C)ccc1C |
| InChI | InChI=1S/C15H22O3/c1-6-17-14(16)15(4,5)10-18-13-9-11(2)7-8-12(13)3/h7-9H,6,10H2,1-5H3 |
| InChIKey | SGAABSAKBHUHDB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |