C16H24O3 — CID 165164903
2-[(2,5-dimethylphenoxy)methyl]-2,4-dimethylpentanoic acid (PubChem CID 165164903) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenoxy)methyl]-2,4-dimethylpentanoic acid.
| Compound Name | 2-[(2,5-dimethylphenoxy)methyl]-2,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 165164903 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-[(2,5-dimethylphenoxy)methyl]-2,4-dimethylpentanoic acid |
| SMILES | Cc1ccc(C)c(OCC(C)(CC(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C16H24O3/c1-11(2)9-16(5,15(17)18)10-19-14-8-12(3)6-7-13(14)4/h6-8,11H,9-10H2,1-5H3,(H,17,18) |
| InChIKey | ARNTUOLINDCSTR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |