C22H31NO6 — CID 18710721
(3-methyl-3-nitroso-2,4-dioxohexyl) 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate (PubChem CID 18710721) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is (3-methyl-3-nitroso-2,4-dioxohexyl) 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate.
| Compound Name | (3-methyl-3-nitroso-2,4-dioxohexyl) 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 18710721 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | (3-methyl-3-nitroso-2,4-dioxohexyl) 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate |
| SMILES | CCC(=O)C(C)(N=O)C(=O)COC(=O)C(C)(C)CCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C22H31NO6/c1-7-18(24)22(6,23-27)19(25)14-29-20(26)21(4,5)11-8-12-28-17-13-15(2)9-10-16(17)3/h9-10,13H,7-8,11-12,14H2,1-6H3 |
| InChIKey | OBJCOEBVCNCEEH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 99.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|