C27H50O4 — CID 142825941
1,4-dimethyl-2-pentoxybenzene;ethane;ethyl 3,3-dimethyl-4-oxohexanoate (PubChem CID 142825941) has the molecular formula C27H50O4 and a molecular weight of 438.69 g/mol. Its IUPAC name is 1,4-dimethyl-2-pentoxybenzene;ethane;ethyl 3,3-dimethyl-4-oxohexanoate.
| Compound Name | 1,4-dimethyl-2-pentoxybenzene;ethane;ethyl 3,3-dimethyl-4-oxohexanoate |
|---|---|
| PubChem CID | 142825941 |
| Molecular Formula | C27H50O4 |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 438.37 |
| IUPAC Name | 1,4-dimethyl-2-pentoxybenzene;ethane;ethyl 3,3-dimethyl-4-oxohexanoate |
| SMILES | CC.CC.CCCCCOc1cc(C)ccc1C.CCOC(=O)CC(C)(C)C(=O)CC |
| InChI | InChI=1S/C13H20O.C10H18O3.2C2H6/c1-4-5-6-9-14-13-10-11(2)7-8-12(13)3;1-5-8(11)10(3,4)7-9(12)13-6-2;2*1-2/h7-8,10H,4-6,9H2,1-3H3;5-7H2,1-4H3;2*1-2H3 |
| InChIKey | IFIINEDWRKIHSM-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|