About methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate
methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate (PubChem CID 21216935) has the molecular formula C13H14Cl2O3S
and a molecular weight of 321.23 g/mol. Its IUPAC name is methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate.
Molecular Properties
| Compound Name | methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate |
| PubChem CID | 21216935 |
| Molecular Formula | C13H14Cl2O3S |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate |
| SMILES | COC(=O)C(C(=O)C(C)(C)S)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2O3S/c1-13(2,19)11(16)10(12(17)18-3)8-5-4-7(14)6-9(8)15/h4-6,10,19H,1-3H3 |
| InChIKey | AQERRSUHEOQAKQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate?
The IUPAC name of methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate (CID 21216935) is methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate.
What is the SMILES notation for methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate?
The canonical SMILES for methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate is COC(=O)C(C(=O)C(C)(C)S)c1ccc(Cl)cc1Cl.
What is the InChIKey of methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate?
The InChIKey is AQERRSUHEOQAKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2O3S/c1-13(2,19)11(16)10(12(17)18-3)8-5-4-7(14)6-9(8)15/h4-6,10,19H,1-3H3.
What are the key properties of methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate?
methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate has a molecular weight of 321.23 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate is sourced from PubChem (CID 21216935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).