C13H14Cl2O3S — CID 21216935
methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate (PubChem CID 21216935) has the molecular formula C13H14Cl2O3S and a molecular weight of 321.23 g/mol. Its IUPAC name is methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate.
| Compound Name | methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate |
|---|---|
| PubChem CID | 21216935 |
| Molecular Formula | C13H14Cl2O3S |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | methyl 2-(2,4-dichlorophenyl)-4-methyl-3-oxo-4-sulfanylpentanoate |
| SMILES | COC(=O)C(C(=O)C(C)(C)S)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2O3S/c1-13(2,19)11(16)10(12(17)18-3)8-5-4-7(14)6-9(8)15/h4-6,10,19H,1-3H3 |
| InChIKey | AQERRSUHEOQAKQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|